CymitQuimica logo

CAS 1257535-25-3

:

N-Methyl-4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]benzenesulfonamide

Description:
N-Methyl-4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]benzenesulfonamide is a chemical compound characterized by its complex structure, which includes a sulfonamide group, a pyridine ring, and a trifluoromethyl substituent. The presence of the sulfonamide functional group suggests potential applications in medicinal chemistry, particularly as a pharmacophore in drug design due to its ability to form hydrogen bonds and interact with biological targets. The trifluoromethyl group enhances lipophilicity and metabolic stability, which can influence the compound's bioavailability and pharmacokinetics. Additionally, the pyridine moiety contributes to the compound's aromaticity and may participate in π-π stacking interactions, further affecting its biological activity. This compound may exhibit properties such as solubility in organic solvents and potential reactivity under specific conditions, making it of interest in various chemical and pharmaceutical applications. Overall, its unique structural features suggest that it could be a candidate for further investigation in drug development or as a research tool in biochemistry.
Formula:C13H11F3N2O3S
InChI:InChI=1S/C13H11F3N2O3S/c1-17-22(19,20)11-4-2-10(3-5-11)21-12-8-9(6-7-18-12)13(14,15)16/h2-8,17H,1H3
InChI key:InChIKey=LPVNWHLBFKWRJS-UHFFFAOYSA-N
SMILES:O(C1=CC(C(F)(F)F)=CC=N1)C2=CC=C(S(NC)(=O)=O)C=C2
Synonyms:
  • Benzenesulfonamide, N-methyl-4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]-
  • N-Methyl-4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]benzenesulfonamide
Found 1 products.