CAS 1257535-37-7: Methyl 3-bromo-1H-indazole-7-carboxylate
Description:Methyl 3-bromo-1H-indazole-7-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 3-position and a carboxylate group at the 7-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The methyl ester functional group enhances its solubility in organic solvents, making it suitable for various chemical reactions. This compound may exhibit biological activity, which is of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure allows for potential interactions with biological targets, and the bromine substituent can influence its electronic properties and reactivity. As with many indazole derivatives, it may also serve as a scaffold for further modifications to explore structure-activity relationships in drug development. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C9H7BrN2O2
InChI:InChI=1S/C9H7BrN2O2/c1-14-9(13)6-4-2-3-5-7(6)11-12-8(5)10/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=TZGIJSHGAUIOST-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CC=CC=2C(Br)=NNC12
- Synonyms:
- Methyl 3-bromo-1H-indazole-7-carboxylate
- 1H-Indazole-7-carboxylic acid, 3-bromo-, methyl ester

Methyl 3-bromo-1H-indazole-7-carboxylate
Ref: IN-DA01FGHA
1g | 105.00 € | ||
100mg | 31.00 € | ||
250mg | 49.00 € |

Methyl 3-bromo-1H-indazole-7-carboxylate
Ref: 54-OR61031
1g | 96.00 € | ||
100mg | 32.00 € |

Methyl 3-bromo-1H-indazole-7-carboxylate
Ref: 10-F725473
1g | 75.00 € | ||
10g | To inquire | ||
250mg | 20.00 € |

Methyl 3-bromo-1H-indazole-7-carboxylate
Ref: 3D-HAC53537
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |