CAS 1257535-39-9

1H-Pyrrolo[3,2-b]pyridin-3-amine, hydrochloride (1:2)

Description:

1H-Pyrrolo[3,2-b]pyridin-3-amine, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridine ring fused together. This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, making it useful in pharmaceutical applications. The presence of the amino group at the 3-position of the pyrrolo-pyridine structure contributes to its potential biological activity, including interactions with various receptors and enzymes. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. The compound is of interest in medicinal chemistry for its potential therapeutic properties, particularly in the development of drugs targeting neurological and psychiatric disorders. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₇H₇N₃·2ClH

InChI: InChI=1S/C7H7N3.2ClH/c8-5-4-10-6-2-1-3-9-7(5)6;;/h1-4,10H,8H2;2*1H

InChI key: InChIKey=HYXDRMBOOYKXJR-UHFFFAOYSA-N

SMILES: NC=1C=2C(=CC=CN2)NC1.Cl

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridin-3-amine, hydrochloride (1:2)

3-Amino-4-azaindole dihydrochloride

CAS: 1257535-39-9

3-Amino-4-azaindole dihydrochloride

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 206.07g/mol

Ref: 54-OR15772