CymitQuimica logo

CAS 1257535-50-4

:

3-Iodo-1,6-dimethyl-1H-indazole

Description:
3-Iodo-1,6-dimethyl-1H-indazole is a chemical compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of the iodo substituent at the 3-position and two methyl groups at the 1 and 6 positions contributes to its unique chemical properties. This compound is typically classified as a heterocyclic aromatic compound, exhibiting potential biological activity due to the presence of the indazole structure, which is known for its involvement in various pharmacological applications. The iodine atom can enhance the compound's reactivity and lipophilicity, potentially influencing its interaction with biological targets. Additionally, the methyl groups can affect the steric and electronic properties of the molecule, impacting its solubility and stability. As with many indazole derivatives, 3-iodo-1,6-dimethyl-1H-indazole may be of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents. However, specific applications and biological activities would require further investigation and research.
Formula:C9H9IN2
InChI:InChI=1S/C9H9IN2/c1-6-3-4-7-8(5-6)12(2)11-9(7)10/h3-5H,1-2H3
InChI key:InChIKey=PPFSZQGRATXJGW-UHFFFAOYSA-N
SMILES:CN1C=2C(C(I)=N1)=CC=C(C)C2
Synonyms:
  • 1H-Indazole, 3-iodo-1,6-dimethyl-
  • 3-Iodo-1,6-dimethyl-indazole
  • 3-Iodo-1,6-dimethyl-1H-indazole
Found 3 products.