CAS 1257535-56-0

Ethyl 3-amino-5-bromo-4-pyridinecarboxylate

Description:

Ethyl 3-amino-5-bromo-4-pyridinecarboxylate is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an amino group (-NH2) at the 3-position and a bromo substituent at the 5-position of the pyridine ring contributes to its reactivity and potential applications in organic synthesis. The ethyl ester functional group at the 4-position enhances its solubility in organic solvents and may influence its biological activity. This compound is typically used in medicinal chemistry and may serve as an intermediate in the synthesis of various pharmaceuticals. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, the presence of halogen and amino groups suggests potential for further functionalization, making it a versatile building block in chemical synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₉BrN₂O₂

InChI: InChI=1S/C8H9BrN2O2/c1-2-13-8(12)7-5(9)3-11-4-6(7)10/h3-4H,2,10H2,1H3

InChI key: InChIKey=SPXGHCFJEVUZOO-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(Br)=CN=CC1N

Synonyms:

• 4-Pyridinecarboxylic acid, 3-amino-5-bromo-, ethyl ester
• Ethyl 3-amino-5-bromo-4-pyridinecarboxylate