CymitQuimica logo

CAS 1257535-66-2

:

3-(2-Aminoethyl)-7-methyl-5H-thiazolo[3,2-a]pyrimidin-5-one

Description:
3-(2-Aminoethyl)-7-methyl-5H-thiazolo[3,2-a]pyrimidin-5-one is a heterocyclic compound characterized by its unique thiazolo and pyrimidinone structures. This compound features a thiazole ring fused to a pyrimidine, which contributes to its potential biological activity. The presence of the aminoethyl group enhances its solubility and may influence its interaction with biological targets. The methyl group at the 7-position of the thiazole ring can affect the compound's electronic properties and steric hindrance, potentially impacting its pharmacological profile. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. As with many heterocycles, it may serve as a scaffold for further modifications to enhance its efficacy or selectivity in therapeutic applications.
Formula:C9H11N3OS
InChI:InChI=1S/C9H11N3OS/c1-6-4-8(13)12-7(2-3-10)5-14-9(12)11-6/h4-5H,2-3,10H2,1H3
InChI key:InChIKey=GMBDOCRDDOKIKF-UHFFFAOYSA-N
SMILES:C(CN)C=1N2C(SC1)=NC(C)=CC2=O
Synonyms:
  • 3-(2-Aminoethyl)-7-methyl-5H-thiazolo[3,2-a]pyrimidin-5-one
  • 5H-Thiazolo[3,2-a]pyrimidin-5-one, 3-(2-aminoethyl)-7-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.