CymitQuimica logo

CAS 1257554-16-7

:

N-Ethyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine

Description:
N-Ethyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine is a chemical compound characterized by its unique structure, which includes a pyridinamine moiety and a boron-containing dioxaborolane group. This compound features a nitrogen atom bonded to both ethyl and methyl groups, contributing to its amine characteristics. The presence of the dioxaborolane group suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions or as a reagent in organic synthesis. The tetramethyl substitution on the dioxaborolane enhances its stability and solubility in organic solvents. Additionally, the pyridine ring may impart specific electronic properties, making the compound of interest in medicinal chemistry and material science. Its molecular structure indicates potential for interactions with biological targets, which could be explored for pharmaceutical applications. Overall, this compound exemplifies the intersection of organic synthesis and functional group chemistry, highlighting the versatility of boron-containing compounds in various chemical contexts.
Formula:C14H23BN2O2
InChI:InChI=1S/C14H23BN2O2/c1-7-17(6)12-9-8-11(10-16-12)15-18-13(2,3)14(4,5)19-15/h8-10H,7H2,1-6H3
InChI key:InChIKey=YCCUMCQJXLFVHM-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=CC(N(CC)C)=NC2
Synonyms:
  • 2-Pyridinamine, N-ethyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • N-Ethyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.