CymitQuimica logo

CAS 1257554-80-5

:

1-isobutyl-3,3-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridin-2(3H)-one

Description:
1-Isobutyl-3,3-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridin-2(3H)-one is a complex organic compound characterized by its unique structural features, including a pyrrolo[2,3-b]pyridine core and a boron-containing moiety. The presence of the isobutyl and dimethyl groups contributes to its hydrophobic characteristics, while the dioxaborolane group may enhance its reactivity and potential for forming coordination complexes. This compound is likely to exhibit interesting chemical properties, such as potential applications in medicinal chemistry or materials science, due to its ability to participate in various chemical reactions, including cross-coupling reactions. Its molecular structure suggests that it may have specific interactions with biological targets, making it a candidate for further investigation in drug development. Additionally, the presence of boron in its structure may impart unique properties, such as increased stability or altered electronic characteristics, which could be advantageous in various applications. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C16H23BN2O3
InChI:InChI=1S/C16H23BN2O3/c1-14(2)11-8-10(9-18-12(11)19(7)13(14)20)17-21-15(3,4)16(5,6)22-17/h8-9H,1-7H3
InChI key:ZRMMDBCWOOMUCF-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N=C2)N(C(=O)C3(C)C)C
Synonyms:
  • 2H-Pyrrolo[2,3-b]pyridin-2-one, 1,3-dihydro-1,3,3-triMethyl-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-
Found 2 products.