
CAS 1257637-94-7
:1-(5-Iodo-2-pyridinyl)cyclobutanecarboxylic acid
Description:
1-(5-Iodo-2-pyridinyl)cyclobutanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a pyridine moiety substituted with an iodine atom. The presence of the carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may exhibit acidic properties. The iodine substitution on the pyridine ring can influence the compound's reactivity, stability, and potential biological activity, as halogen atoms often enhance lipophilicity and can affect molecular interactions. This compound may be of interest in medicinal chemistry and drug development due to its potential pharmacological properties. Additionally, its molecular structure suggests it could be involved in various synthetic pathways, making it a valuable intermediate in organic synthesis. The compound's solubility, melting point, and other physical properties would depend on its specific interactions with solvents and other chemical environments. Overall, 1-(5-Iodo-2-pyridinyl)cyclobutanecarboxylic acid represents a versatile structure with potential applications in various fields of chemistry.
Formula:C10H10INO2
InChI:InChI=1S/C10H10INO2/c11-7-2-3-8(12-6-7)10(9(13)14)4-1-5-10/h2-3,6H,1,4-5H2,(H,13,14)
InChI key:InChIKey=VOLCXOWPTGJRKH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CCC1)C2=CC=C(I)C=N2
Synonyms:- 1-(5-Iodo-2-pyridinyl)cyclobutanecarboxylic acid
- Cyclobutanecarboxylic acid, 1-(5-iodo-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.