CAS 1257642-74-2

1,10-Phenanthroline-3,8-disulfonic acid, 2,9-dimethyl-4,7-diphenyl-, sodium salt, hydrate (1:2:1)

Description:

1,10-Phenanthroline-3,8-disulfonic acid, 2,9-dimethyl-4,7-diphenyl-, sodium salt, hydrate (1:2:1) is a complex organic compound characterized by its phenanthroline backbone, which is a polycyclic aromatic structure known for its chelating properties. This compound features sulfonic acid groups that enhance its solubility in water and contribute to its acidic nature. The presence of sodium ions indicates that it is a salt, which typically enhances its stability and solubility in aqueous solutions. The dimethyl and diphenyl substitutions on the phenanthroline structure can influence its electronic properties and reactivity, making it useful in various applications, including as a chelating agent for metal ions in analytical chemistry. Additionally, the hydrate form suggests that it can incorporate water molecules into its crystalline structure, which may affect its physical properties such as melting point and solubility. Overall, this compound is notable for its potential applications in coordination chemistry and as a reagent in various chemical analyses.

Formula: C₂₆H₂₀N₂O₆S₂·H₂O·2Na

InChI: InChI=1S/C26H20N2O6S2.2Na.H2O/c1-15-25(35(29,30)31)21(17-9-5-3-6-10-17)19-13-14-20-22(18-11-7-4-8-12-18)26(36(32,33)34)16(2)28-24(20)23(19)27-15;;;/h3-14H,1-2H3,(H,29,30,31)(H,32,33,34);;;1H2

InChI key: InChIKey=BQHNRHAUQHHXMD-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C1=C(C=2C(=C3C(=CC2)C(=C(S(=O)(=O)O)C(C)=N3)C4=CC=CC=C4)N=C1C)C5=CC=CC=C5.[Na].O

Synonyms:

• 1,10-Phenanthroline-3,8-disulfonic acid, 2,9-dimethyl-4,7-diphenyl-, sodium salt, hydrate (1:2:1)

2,9-DIMETHYL-4,7-DIPHENYL-1,10-PHENANTHROLINEDISULFONIC ACID, DISODIUM SALT HYDRATE

CAS: 1257642-74-2

Formula: C₂₆H₂₀N₂Na₂O₇S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 582.5557

Ref: IN-DA009IPJ

Sodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate hydrate

CAS: 1257642-74-2

Sodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate hydrate

Purity: 98%

Ref: 54-OR1042394

Bathocuproine disulfonic acid disodium salt hydrate

CAS: 1257642-74-2

Bathocuproine disulfonic acid disodium salt hydrate is a copper complex that can be used for the analysis of urine samples. It is a multicellular animal-specific enzyme inhibitor that binds to phosphatase, which is an important component in the metabolism of carbohydrates and proteins. Bathocuproine disulfonic acid disodium salt hydrate inhibits the activity of this enzyme by forming a stable copper complex, thereby preventing the hydrolysis of phosphoric esters. Bathocuproine disulfonic acid disodium salt hydrate has been shown to inhibit growth factor activity in human serum, while inhibiting the reaction vessel corrosion process. This compound also contains functional groups such as sulfonic acid, carboxylate and sulfonamide groups.

Formula: C₂₆H₁₈N₂Na₂O₆S₂·xH₂O

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 584.57 g/mol

Ref: 3D-FB32419

Sodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate hydrate

CAS: 1257642-74-2

Purity: 98%

Molecular weight: 582.05

Ref: 10-F553041