CAS 1257664-91-7

4-Bromo-2-methoxy-N-(1-methylethyl)benzamide

Description:

4-Bromo-2-methoxy-N-(1-methylethyl)benzamide is an organic compound characterized by its aromatic structure, which includes a bromine atom and a methoxy group attached to a benzene ring. The presence of the bromine substituent typically imparts certain reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions. The methoxy group contributes to the compound's overall polarity and can influence its solubility in organic solvents. The N-(1-methylethyl) moiety indicates the presence of an isopropyl group, which can affect the steric hindrance around the amide bond, potentially influencing its reactivity and interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 4-Bromo-2-methoxy-N-(1-methylethyl)benzamide represents a versatile structure in organic synthesis and medicinal applications.

Formula: C₁₁H₁₄BrNO₂

InChI: InChI=1S/C11H14BrNO2/c1-7(2)13-11(14)9-5-4-8(12)6-10(9)15-3/h4-7H,1-3H3,(H,13,14)

InChI key: InChIKey=MGDMNUHBCPEELO-UHFFFAOYSA-N

SMILES: C(NC(C)C)(=O)C1=C(OC)C=C(Br)C=C1

Synonyms:

• Benzamide, 4-bromo-2-methoxy-N-(1-methylethyl)-
• 4-Bromo-2-methoxy-N-(1-methylethyl)benzamide

N-Isopropyl 4-bromo-2-methoxybenzamide

CAS: 1257664-91-7

Formula: C₁₁H₁₄BrNO₂

Molecular weight: 272.1384

Ref: IN-DA000OOI