CAS 1257664-97-3
:Methanone, (4-bromo-2-methoxyphenyl)-1-pyrrolidinyl-
Description:
Methanone, (4-bromo-2-methoxyphenyl)-1-pyrrolidinyl- is a chemical compound characterized by its complex structure, which includes a methanone functional group, a brominated aromatic ring, and a pyrrolidine moiety. The presence of the 4-bromo substituent on the aromatic ring enhances its reactivity and influences its electronic properties, while the methoxy group contributes to its solubility and potential interactions in biological systems. The pyrrolidine ring adds to the compound's structural diversity and may affect its pharmacological properties. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its unique combination of functional groups suggests potential applications in various fields, including pharmaceuticals and agrochemicals. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its characteristics and potential uses.
Formula:C12H14BrNO2
InChI:InChI=1S/C12H14BrNO2/c1-16-11-8-9(13)4-5-10(11)12(15)14-6-2-3-7-14/h4-5,8H,2-3,6-7H2,1H3
InChI key:InChIKey=VBRHKYBMZIGYMK-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C=C(Br)C=C1)N2CCCC2
Synonyms:- (4-Bromo-2methoxyphenyl)(pyrrolidin-1-yl)methanone
- Methanone, (4-bromo-2-methoxyphenyl)-1-pyrrolidinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
