CAS 1257665-01-2

5-Fluoro-4′-hydroxy[1,1′-biphenyl]-3-carboxylic acid

Description:

5-Fluoro-4′-hydroxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 5-position and a hydroxyl group at the 4′-position on one of the phenyl rings contributes to its unique chemical properties, including potential biological activity. The carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents. This compound may exhibit interesting interactions in biological systems, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various potential applications, including as a building block in organic synthesis or as a ligand in coordination chemistry. Additionally, the presence of both electron-withdrawing (fluorine) and electron-donating (hydroxyl) groups can influence its reactivity and stability, making it a subject of study in both theoretical and applied chemistry contexts.

Formula: C₁₃H₉FO₃

InChI: InChI=1S/C13H9FO3/c14-11-6-9(5-10(7-11)13(16)17)8-1-3-12(15)4-2-8/h1-7,15H,(H,16,17)

InChI key: InChIKey=AHDOCVLIQKICRL-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=C(F)C1)C2=CC=C(O)C=C2

Synonyms:

• 5-Fluoro-4′-hydroxy[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 5-fluoro-4′-hydroxy-

4-(3-Carboxy-5-fluorophenyl)phenol

CAS: 1257665-01-2

Formula: C₁₃H₉FO₃

Molecular weight: 232.2072

Ref: IN-DA000OOB