CAS 1257665-02-3
:4-Bromo-N-cyclohexyl-2-methoxybenzamide
Description:
4-Bromo-N-cyclohexyl-2-methoxybenzamide is a chemical compound characterized by its unique structure, which includes a bromine atom, a cyclohexyl group, and a methoxybenzamide moiety. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and biological activity. The cyclohexyl group contributes to the compound's hydrophobic characteristics, potentially affecting its solubility in various solvents. The methoxy group enhances the electron-donating properties of the aromatic ring, which can impact the compound's interaction with biological targets. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific receptors or enzymes. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 4-Bromo-N-cyclohexyl-2-methoxybenzamide represents a complex organic molecule with potential utility in various chemical and biological applications.
Formula:C14H18BrNO2
InChI:InChI=1S/C14H18BrNO2/c1-18-13-9-10(15)7-8-12(13)14(17)16-11-5-3-2-4-6-11/h7-9,11H,2-6H2,1H3,(H,16,17)
InChI key:InChIKey=HOULYZIFUYMJFL-UHFFFAOYSA-N
SMILES:C(NC1CCCCC1)(=O)C2=C(OC)C=C(Br)C=C2
Synonyms:- Benzamide, 4-bromo-N-cyclohexyl-2-methoxy-
- 4-Bromo-N-cyclohexyl-2-methoxybenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
