CAS 1257665-05-6
:2,4-Dibromo-1-(2-methoxyethoxy)benzene
Description:
2,4-Dibromo-1-(2-methoxyethoxy)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two bromine atoms at the 2 and 4 positions and a 2-methoxyethoxy group at the 1 position. This compound is typically a colorless to light yellow liquid or solid, depending on its purity and temperature. The presence of bromine atoms contributes to its reactivity, making it useful in various chemical synthesis applications, particularly in the field of pharmaceuticals and agrochemicals. The methoxyethoxy group enhances its solubility in organic solvents, which can facilitate its use in different chemical reactions. Additionally, the compound may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures during its use in laboratory or industrial settings. Its unique structure allows for potential applications in material science and as an intermediate in organic synthesis. As with any chemical substance, proper characterization and understanding of its properties are essential for safe and effective utilization.
Formula:C9H10Br2O2
InChI:InChI=1S/C9H10Br2O2/c1-12-4-5-13-9-3-2-7(10)6-8(9)11/h2-3,6H,4-5H2,1H3
InChI key:InChIKey=NIFYOSWBUVGSGU-UHFFFAOYSA-N
SMILES:O(CCOC)C1=C(Br)C=C(Br)C=C1
Synonyms:- Benzene, 2,4-dibromo-1-(2-methoxyethoxy)-
- 2,4-Dibromo-1-(2-methoxyethoxy)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
