CAS 1257665-15-8
:2-[(2,4-Dibromophenoxy)methyl]tetrahydro-2H-pyran
Description:
2-[(2,4-Dibromophenoxy)methyl]tetrahydro-2H-pyran is an organic compound characterized by its complex structure, which includes a tetrahydropyran ring and a dibromophenoxy group. This compound features a tetrahydro-2H-pyran moiety, which is a six-membered cyclic ether with five carbon atoms and one oxygen atom, contributing to its potential solubility in organic solvents. The presence of the 2,4-dibromophenoxy group introduces significant polarity and may enhance its reactivity due to the electron-withdrawing effects of the bromine atoms. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of bromine atoms may influence its physical properties, such as melting and boiling points, as well as its stability under various conditions. Overall, 2-[(2,4-Dibromophenoxy)methyl]tetrahydro-2H-pyran is a compound of interest due to its unique structural features and potential applications in various fields.
Formula:C12H14Br2O2
InChI:InChI=1S/C12H14Br2O2/c13-9-4-5-12(11(14)7-9)16-8-10-3-1-2-6-15-10/h4-5,7,10H,1-3,6,8H2
InChI key:InChIKey=IYZIDIBXMQILDD-UHFFFAOYSA-N
SMILES:O(CC1CCCCO1)C2=C(Br)C=C(Br)C=C2
Synonyms:- 2H-Pyran, 2-[(2,4-dibromophenoxy)methyl]tetrahydro-
- 2-[(2,4-Dibromophenoxy)methyl]tetrahydro-2H-pyran
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
