CAS 1257665-16-9
:1,1-Dimethylethyl 4-[(3,5-dibromophenoxy)methyl]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 4-[(3,5-dibromophenoxy)methyl]-1-piperidinecarboxylate, identified by its CAS number 1257665-16-9, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a dibromophenoxy group. This compound typically exhibits properties associated with both lipophilicity and potential biological activity due to the presence of halogen substituents and functional groups. The piperidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often linked to various biological activities. The dibromophenoxy group may enhance the compound's reactivity and interaction with biological targets. Additionally, the presence of the tert-butyl group (1,1-dimethylethyl) can influence the compound's steric properties and solubility. Overall, this compound's unique structural features may contribute to its potential utility in research and development within the fields of organic chemistry and drug design.
Formula:C17H23Br2NO3
InChI:InChI=1S/C17H23Br2NO3/c1-17(2,3)23-16(21)20-6-4-12(5-7-20)11-22-15-9-13(18)8-14(19)10-15/h8-10,12H,4-7,11H2,1-3H3
InChI key:InChIKey=KFYHCQLOMWOCOI-UHFFFAOYSA-N
SMILES:O(CC1CCN(C(OC(C)(C)C)=O)CC1)C2=CC(Br)=CC(Br)=C2
Synonyms:- 1-Piperidinecarboxylic acid, 4-[(3,5-dibromophenoxy)methyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 4-[(3,5-dibromophenoxy)methyl]-1-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
