CAS 1257665-18-1
:Quinoline, 6-bromo-8-methyl-, hydrochloride (1:1)
Description:
Quinoline, 6-bromo-8-methyl-, hydrochloride (1:1) is a chemical compound characterized by its quinoline backbone, which is a bicyclic aromatic structure containing a nitrogen atom. The presence of a bromine atom at the 6-position and a methyl group at the 8-position contributes to its unique reactivity and properties. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in polar solvents, particularly water. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure allows for potential interactions with various biological targets, which could lead to applications in drug development. Additionally, the bromine substituent can facilitate further chemical modifications, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health risks. Overall, Quinoline, 6-bromo-8-methyl-, hydrochloride (1:1) represents a significant compound in the realm of organic and medicinal chemistry.
Formula:C10H8BrN·ClH
InChI:InChI=1S/C10H8BrN.ClH/c1-7-5-9(11)6-8-3-2-4-12-10(7)8;/h2-6H,1H3;1H
InChI key:InChIKey=WIILIZHVRUWNMP-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=C(Br)C1)C=CC=N2.Cl
Synonyms:- Quinoline, 6-bromo-8-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
