CymitQuimica logo

CAS 1257665-19-2

:

1-[2-Bromo-5-(trifluoromethyl)phenyl]-2-piperidinone

Description:
1-[2-Bromo-5-(trifluoromethyl)phenyl]-2-piperidinone is a chemical compound characterized by its complex structure, which includes a piperidinone moiety and a brominated aromatic ring with a trifluoromethyl group. The presence of the bromine atom and the trifluoromethyl group contributes to its unique reactivity and lipophilicity, making it of interest in medicinal chemistry and material science. This compound typically exhibits moderate to high solubility in organic solvents, while its polar functional groups may impart some degree of hydrophilicity. The trifluoromethyl group is known to enhance the metabolic stability of compounds, potentially influencing pharmacokinetic properties. Additionally, the compound may exhibit biological activity, which can be explored in various therapeutic contexts. Its molecular structure suggests potential applications in drug development, particularly in the design of novel pharmaceuticals targeting specific biological pathways. Safety and handling precautions should be observed due to the presence of halogenated compounds, which may pose environmental and health risks.
Formula:C12H11BrF3NO
InChI:InChI=1S/C12H11BrF3NO/c13-9-5-4-8(12(14,15)16)7-10(9)17-6-2-1-3-11(17)18/h4-5,7H,1-3,6H2
InChI key:InChIKey=ZUXYXQMGYJUMLU-UHFFFAOYSA-N
SMILES:BrC=1C(=CC(C(F)(F)F)=CC1)N2C(=O)CCCC2
Synonyms:
  • 2-Piperidinone, 1-[2-bromo-5-(trifluoromethyl)phenyl]-
  • 1-[2-Bromo-5-(trifluoromethyl)phenyl]-2-piperidinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.