CAS 1257665-21-6
:Tetrahydro-2-[[3-(trifluoromethyl)phenoxy]methyl]-2H-pyran
Description:
Tetrahydro-2-[[3-(trifluoromethyl)phenoxy]methyl]-2H-pyran, identified by its CAS number 1257665-21-6, is a chemical compound characterized by its unique structural features, including a tetrahydropyran ring and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both its cyclic ether structure and the presence of the trifluoromethyl group, which can enhance lipophilicity and influence biological activity. The trifluoromethyl group is known for its electron-withdrawing properties, which can affect the reactivity and stability of the molecule. In terms of solubility, compounds of this nature may show varying degrees of solubility in organic solvents, while their polar characteristics can influence interactions with biological systems. Additionally, the presence of the phenoxy group may impart specific functional properties, making this compound of interest in medicinal chemistry and material science. Overall, the combination of these structural elements contributes to the compound's potential applications and reactivity in various chemical contexts.
Formula:C13H15F3O2
InChI:InChI=1S/C13H15F3O2/c14-13(15,16)10-4-3-6-11(8-10)18-9-12-5-1-2-7-17-12/h3-4,6,8,12H,1-2,5,7,9H2
InChI key:InChIKey=PIVAHMJYMPDCKX-UHFFFAOYSA-N
SMILES:O(CC1CCCCO1)C2=CC(C(F)(F)F)=CC=C2
Synonyms:- 2H-Pyran, tetrahydro-2-[[3-(trifluoromethyl)phenoxy]methyl]-
- Tetrahydro-2-[[3-(trifluoromethyl)phenoxy]methyl]-2H-pyran
- 2-(3-Trifluoromethylphenoxy)methyltetrahydro-2H-pyran
- 2-[[3-(trifluoromethyl)phenoxy]methyl]oxane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(3-Trifluoromethylphenoxy)methyltetrahydro-2H-pyran
CAS:Formula:C13H15F3O2Molecular weight:260.2522
