CAS 125768-93-6
:1,1-Dimethylpropyl 1-methoxycyclohexyl peroxide
Description:
1,1-Dimethylpropyl 1-methoxycyclohexyl peroxide, identified by its CAS number 125768-93-6, is an organic peroxide compound characterized by its structure, which includes a peroxide functional group (-O-O-) linked to a cyclohexyl moiety. This compound typically exhibits properties common to organic peroxides, such as being a colorless to pale yellow liquid with a distinct odor. It is known for its thermal instability, which can lead to decomposition, releasing oxygen and potentially causing combustion under certain conditions. As a peroxide, it serves as a radical initiator in various polymerization reactions, making it valuable in the production of plastics and resins. However, due to its reactive nature, it requires careful handling and storage away from heat sources and incompatible materials. Safety precautions are essential, as organic peroxides can pose risks of explosion and skin irritation. Overall, 1,1-Dimethylpropyl 1-methoxycyclohexyl peroxide is significant in industrial applications, particularly in the field of polymer chemistry.
Formula:C12H24O3
InChI:InChI=1S/C12H24O3/c1-5-11(2,3)14-15-12(13-4)9-7-6-8-10-12/h5-10H2,1-4H3
InChI key:InChIKey=MGIDEDVBLNEGDG-UHFFFAOYSA-N
SMILES:O(OC(CC)(C)C)C1(OC)CCCCC1
Synonyms:- Luperox 510
- 1-Methoxy-1-(2-methylbutan-2-ylperoxy)cyclohexane
- Luperox V 10
- 1,1-Dimethylpropyl 1-methoxycyclohexyl peroxide
- Peroxide, 1,1-dimethylpropyl 1-methoxycyclohexyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
