CymitQuimica logo

CAS 125774-46-1

:

1,1,1-trifluoro-3-thiophen-3-ylpropan-2-one

Description:
1,1,1-Trifluoro-3-thiophen-3-ylpropan-2-one, with the CAS number 125774-46-1, is an organic compound characterized by the presence of a trifluoromethyl group and a thiophene ring. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The trifluoromethyl group enhances the lipophilicity and stability of the molecule, making it of interest in medicinal chemistry and agrochemicals. The thiophene moiety introduces aromatic characteristics, which can influence the electronic properties and reactivity of the compound. Additionally, the presence of fluorine atoms often imparts unique physical properties, such as increased boiling points and altered solubility profiles. This compound may exhibit biological activity, making it a candidate for further research in drug development or as a building block in the synthesis of more complex molecules. Overall, its unique structural features position it as a valuable compound in various chemical applications.
Formula:C7H5F3OS
InChI:InChI=1/C7H5F3OS/c8-7(9,10)6(11)3-5-1-2-12-4-5/h1-2,4H,3H2
SMILES:c1cscc1CC(=O)C(F)(F)F
Synonyms:
  • 1,1,1-Trifluor-3-(3-thienyl)aceton
  • 1,1,1-Trifluoro-3-(3-Thienyl)Acetone
  • 2-Propanone, 1,1,1-Trifluoro-3-(3-Thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.