
CAS 125781-04-6
:(3S)-4-Chloro-3-hydroxybutanal
Description:
(3S)-4-Chloro-3-hydroxybutanal is an organic compound characterized by its functional groups, which include a hydroxyl (-OH) group and an aldehyde (-CHO) group, along with a chlorine atom attached to the butanal backbone. This compound is a chiral molecule, with the "3S" designation indicating the specific stereochemistry at the third carbon atom. Its molecular structure suggests that it may exhibit both polar and nonpolar characteristics due to the presence of the hydroxyl group, which can engage in hydrogen bonding, and the aldehyde group, which is reactive and can participate in various chemical reactions, such as oxidation and condensation. The chlorine substituent can influence the compound's reactivity and solubility in different solvents. As a result, (3S)-4-Chloro-3-hydroxybutanal may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, where its unique structural features can be utilized for specific chemical transformations.
Formula:C4H7ClO2
InChI:InChI=1S/C4H7ClO2/c5-3-4(7)1-2-6/h2,4,7H,1,3H2/t4-/m0/s1
InChI key:InChIKey=XQXWWWKGIMBNKZ-BYPYZUCNSA-N
SMILES:[C@H](CC=O)(CCl)O
Synonyms:- 4-Chloro-3-(S)-hydroxybutyraldehyde
- Butanal, 4-chloro-3-hydroxy-, (S)-
- (3S)-4-Chloro-3-hydroxybutanal
- Butanal, 4-chloro-3-hydroxy-, (3S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.