CymitQuimica logo

CAS 1257832-57-7

:

2-Bromo-5-methoxy-4-(2,2,2-trifluoroethyl)benzenamine

Description:
2-Bromo-5-methoxy-4-(2,2,2-trifluoroethyl)benzenamine is an organic compound characterized by its aromatic structure, which includes a bromine atom, a methoxy group, and a trifluoroethyl substituent on a benzene ring. The presence of the bromine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methoxy group enhances the compound's solubility in organic solvents and can influence its electronic properties, potentially affecting its reactivity and interaction with biological systems. The trifluoroethyl group introduces significant steric hindrance and alters the compound's lipophilicity, which may impact its pharmacokinetic properties if considered for pharmaceutical applications. Additionally, the compound's structure suggests potential applications in medicinal chemistry, agrochemicals, or materials science, depending on its specific properties and reactivity. Safety and handling precautions should be observed due to the presence of halogenated groups, which can pose environmental and health risks.
Formula:C9H9BrF3NO
InChI:InChI=1S/C9H9BrF3NO/c1-15-8-3-7(14)6(10)2-5(8)4-9(11,12)13/h2-3H,4,14H2,1H3
InChI key:InChIKey=IMFOOHXKXDFQHJ-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)C1=C(OC)C=C(N)C(Br)=C1
Synonyms:
  • 2-Bromo-5-methoxy-4-(2,2,2-trifluoroethyl)benzenamine
  • Benzenamine, 2-bromo-5-methoxy-4-(2,2,2-trifluoroethyl)-
  • 2-Bromo-5-methoxy-4-(2,2,2-trifluoroethyl)aniline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.