CAS 1257832-92-0

7-Bromo-2-(1,1-dimethylethyl)-1-naphthalenol

Description:

7-Bromo-2-(1,1-dimethylethyl)-1-naphthalenol is an organic compound characterized by its naphthalene structure, which consists of two fused benzene rings. The presence of a bromine atom at the 7-position and a tert-butyl group at the 2-position contributes to its unique chemical properties. This compound features a hydroxyl (-OH) group, indicating it is an alcohol, which can influence its solubility and reactivity. The bulky tert-butyl group enhances steric hindrance, potentially affecting its interactions with other molecules and its overall reactivity. The bromine substituent can also participate in various chemical reactions, such as nucleophilic substitution or elimination reactions. This compound may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its structural features that can modulate biological activity. Additionally, its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied.

Formula: C₁₄H₁₅BrO

InChI: InChI=1S/C14H15BrO/c1-14(2,3)12-7-5-9-4-6-10(15)8-11(9)13(12)16/h4-8,16H,1-3H3

InChI key: InChIKey=IXWOIPRSINXPIZ-UHFFFAOYSA-N

SMILES: OC=1C2=C(C=CC1C(C)(C)C)C=CC(Br)=C2

Synonyms:

• 7-Bromo-2-(1,1-dimethylethyl)-1-naphthalenol
• 1-Naphthalenol, 7-bromo-2-(1,1-dimethylethyl)-