CAS 1257848-43-3
:(3R)-3-Morpholineacetic acid
Description:
(3R)-3-Morpholineacetic acid is an organic compound characterized by its morpholine ring structure, which contributes to its unique chemical properties. As a chiral molecule, it exists in a specific stereoisomeric form, which can influence its biological activity and interactions. This compound features a carboxylic acid functional group, making it acidic in nature, and it can participate in various chemical reactions typical of amino acids and related compounds. Its morpholine moiety provides potential for hydrogen bonding and solubility in polar solvents, enhancing its reactivity and utility in pharmaceutical applications. The presence of both the morpholine and acetic acid components suggests potential roles in medicinal chemistry, particularly in the development of drugs targeting neurological or metabolic pathways. Additionally, the compound's structure may allow for interactions with biological receptors, making it a candidate for further research in drug design and synthesis. Overall, (3R)-3-Morpholineacetic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C6H11NO3
InChI:InChI=1S/C6H11NO3/c8-6(9)3-5-4-10-2-1-7-5/h5,7H,1-4H2,(H,8,9)/t5-/m1/s1
InChI key:InChIKey=FOXWWHUTFBNJFX-RXMQYKEDSA-N
SMILES:C(C(O)=O)[C@@H]1COCCN1
Synonyms:- 3-Morpholineacetic acid, (3R)-
- (3R)-3-Morpholineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
