CymitQuimica logo

CAS 1257849-26-5

:

Ethyl 3-chloro-1,8a-dihydroimidazo[1,2-a]pyridine-8-carboxylate

Description:
Ethyl 3-chloro-1,8a-dihydroimidazo[1,2-a]pyridine-8-carboxylate is a chemical compound characterized by its unique imidazo-pyridine structure, which incorporates both a chloro substituent and an ethyl ester functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its nitrogen-containing ring system. The presence of the chloro group can influence its reactivity and solubility, while the ethyl ester moiety may enhance its lipophilicity, making it more amenable for various applications in medicinal chemistry. Its molecular structure suggests potential uses in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many heterocycles, it may also exhibit interesting spectroscopic properties, making it suitable for characterization through techniques like NMR and mass spectrometry. Overall, this compound represents a class of molecules that could be of interest in drug discovery and development.
Formula:C10H11ClN2O2
InChI:InChI=1S/C10H11ClN2O2/c1-2-15-10(14)7-4-3-5-13-8(11)6-12-9(7)13/h3-6,9,12H,2H2,1H3
InChI key:InChIKey=DKBXSZXCQBIZDE-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C2N(C(Cl)=CN2)C=CC1
Synonyms:
  • Ethyl 3-chloro-1,8a-dihydroimidazo[1,2-a]pyridine-8-carboxylate
  • Imidazo[1,2-a]pyridine-8-carboxylic acid, 3-chloro-1,8a-dihydro-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.