CAS 1257853-00-1

1-Piperazineacetamide, N-(4-phenoxyphenyl)-, hydrochloride (1:2)

Description:

1-Piperazineacetamide, N-(4-phenoxyphenyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperazine and acetamide functional groups, which contribute to its potential biological activity. The presence of the phenoxyphenyl moiety suggests that it may exhibit interesting pharmacological properties, possibly related to its interactions with various biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound's structure indicates it may participate in hydrogen bonding due to the amide group, which can influence its reactivity and interaction with other molecules. Additionally, the piperazine ring may provide basic properties, allowing for potential interactions with acidic sites in biological systems. Overall, this compound's unique structural features suggest it could be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activity and safety profiles would require further investigation through experimental studies.

Formula: C₁₈H₂₁N₃O₂·2ClH

InChI: InChI=1S/C18H21N3O2.2ClH/c22-18(14-21-12-10-19-11-13-21)20-15-6-8-17(9-7-15)23-16-4-2-1-3-5-16;;/h1-9,19H,10-14H2,(H,20,22);2*1H

InChI key: InChIKey=JUFGATHGCMHFBC-UHFFFAOYSA-N

SMILES: O(C1=CC=C(NC(CN2CCNCC2)=O)C=C1)C3=CC=CC=C3.Cl

Synonyms:

• 1-Piperazineacetamide, N-(4-phenoxyphenyl)-, hydrochloride (1:2)