CymitQuimica logo

CAS 1257855-08-5

:

2-Phenoxy-N-[(3S)-tetrahydro-2,5-dioxo-3-furanyl]acetamide

Description:
2-Phenoxy-N-[(3S)-tetrahydro-2,5-dioxo-3-furanyl]acetamide is a chemical compound characterized by its unique structural features, which include a phenoxy group and a tetrahydrofuran moiety with dioxo functionality. This compound belongs to the class of amides, indicating the presence of a carbonyl group (C=O) linked to a nitrogen atom (N). The tetrahydrofuran ring contributes to its cyclic structure, while the dioxo groups enhance its reactivity and potential biological activity. The stereochemistry at the 3-position of the tetrahydrofuran indicates that it has specific spatial arrangements, which can influence its interactions in biological systems. This compound may exhibit properties such as solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals, given the presence of functional groups that can participate in various chemical reactions. Its specific characteristics, including melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Further research would be necessary to fully elucidate its properties and potential applications.
Formula:C12H11NO5
InChI:InChI=1S/C12H11NO5/c14-10(7-17-8-4-2-1-3-5-8)13-9-6-11(15)18-12(9)16/h1-5,9H,6-7H2,(H,13,14)/t9-/m0/s1
InChI key:InChIKey=JFNLOKSSJKJODB-VIFPVBQESA-N
SMILES:N(C(COC1=CC=CC=C1)=O)[C@@H]2C(=O)OC(=O)C2
Synonyms:
  • 2-Phenoxy-N-[(3S)-tetrahydro-2,5-dioxo-3-furanyl]acetamide
  • Acetamide, 2-phenoxy-N-[(3S)-tetrahydro-2,5-dioxo-3-furanyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.