CAS 1257856-34-0

4-Piperidineacetamide, N-[(4-methylphenyl)methyl]-, hydrochloride (1:1)

Description:

4-Piperidineacetamide, N-[(4-methylphenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an acetamide functional group, indicating the presence of a carbonyl group (C=O) attached to a nitrogen atom, contributing to its potential as a pharmacologically active agent. The presence of a 4-methylphenyl group suggests that it has aromatic characteristics, which can influence its solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. The compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its specific interactions and effects would depend on its molecular structure and the functional groups present. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₁₅H₂₂N₂O·ClH

InChI: InChI=1S/C15H22N2O.ClH/c1-12-2-4-14(5-3-12)11-17-15(18)10-13-6-8-16-9-7-13;/h2-5,13,16H,6-11H2,1H3,(H,17,18);1H

InChI key: InChIKey=LUCSHCHKLODLHJ-UHFFFAOYSA-N

SMILES: C(C(NCC1=CC=C(C)C=C1)=O)C2CCNCC2.Cl

Synonyms:

• 4-Piperidineacetamide, N-[(4-methylphenyl)methyl]-, hydrochloride (1:1)