CAS 1257856-43-1

4-Piperidineacetic acid, 1-(3-pyridinylmethyl)-, methyl ester, hydrochloride (1:2)

Description:

4-Piperidineacetic acid, 1-(3-pyridinylmethyl)-, methyl ester, hydrochloride (1:2) is a chemical compound characterized by its piperidine and pyridine moieties, which contribute to its biological activity and potential pharmacological applications. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, reflecting its ionic nature due to the hydrochloride salt form. The presence of both piperidine and pyridine rings suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The methyl ester functional group may enhance lipophilicity, influencing its absorption and distribution in biological systems. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. The compound's specific properties, such as melting point, boiling point, and spectral data, would be essential for further characterization and application in research or pharmaceutical development. Overall, this compound's unique structure positions it as a candidate for further investigation in drug discovery and development.

Formula: C₁₄H₂₀N₂O₂·2ClH

InChI: InChI=1S/C14H20N2O2.2ClH/c1-18-14(17)9-12-4-7-16(8-5-12)11-13-3-2-6-15-10-13;;/h2-3,6,10,12H,4-5,7-9,11H2,1H3;2*1H

InChI key: InChIKey=QSHRKAKQVBEUSN-UHFFFAOYSA-N

SMILES: C(N1CCC(CC(OC)=O)CC1)C=2C=CC=NC2.Cl

Synonyms:

• 4-Piperidineacetic acid, 1-(3-pyridinylmethyl)-, methyl ester, hydrochloride (1:2)