
CAS 1257879-78-9
:B-(4-Phenyl-2-pyridinyl)boronic acid
Description:
B-(4-Phenyl-2-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is further substituted with a phenyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the pyridine and phenyl groups contributes to its potential as a ligand in coordination chemistry and as a building block in the synthesis of more complex molecules. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. The compound's solubility and reactivity can vary based on the pH of the solution, as boronic acids can exist in different forms depending on protonation. Overall, B-(4-Phenyl-2-pyridinyl)boronic acid is a versatile compound with significant implications in chemical research and development.
Formula:C11H10BNO2
InChI:InChI=1S/C11H10BNO2/c14-12(15)11-8-10(6-7-13-11)9-4-2-1-3-5-9/h1-8,14-15H
InChI key:InChIKey=NEPURTHDALWQGM-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC(=CC=N1)C2=CC=CC=C2
Synonyms:- Boronic acid, B-(4-phenyl-2-pyridinyl)-
- B-(4-Phenyl-2-pyridinyl)boronic acid
- (4-Phenylpyridin-2-yl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.