CymitQuimica logo

CAS 125794-21-0

:

Acetamide, 2-chloro-N-(4-pyridinylmethyl)-

Description:
Acetamide, 2-chloro-N-(4-pyridinylmethyl)-, is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a chloro substituent at the second position of the acetamide structure and a pyridinylmethyl group, indicating the presence of a pyridine ring attached to a methyl group. The molecular structure suggests that it may exhibit polar characteristics due to the presence of the amide group, which can engage in hydrogen bonding. The chloro substituent can influence the compound's reactivity and solubility in various solvents. Acetamides are often studied for their biological activity, and this specific compound may have potential applications in medicinal chemistry or as a building block in organic synthesis. Its unique structure may contribute to specific interactions with biological targets, making it of interest in drug development. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C8H9ClN2O
InChI:InChI=1S/C8H9ClN2O/c9-5-8(12)11-6-7-1-3-10-4-2-7/h1-4H,5-6H2,(H,11,12)
InChI key:IQFAKYPKZTXHMQ-UHFFFAOYSA-N
SMILES:C1=CN=CC=C1CNC(=O)CCl
Found 3 products.