
CAS 125802-18-8
:Cyclohexanamine, 1-(3-fluorophenyl)-, hydrochloride (1:1)
Description:
Cyclohexanamine, 1-(3-fluorophenyl)-, hydrochloride (1:1), with the CAS number 125802-18-8, is a chemical compound characterized by its amine functional group and a cyclohexane ring structure. This substance features a fluorophenyl group, which introduces a fluorine atom at the para position relative to the amine, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The presence of the amine group suggests basic properties, while the fluorine substitution may impart unique electronic characteristics, affecting interactions with biological targets. Cyclohexanamine derivatives are often studied for their potential in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions. Safety and handling precautions are essential, as with many amines and their salts, due to potential toxicity and reactivity.
Formula:C12H16FN·ClH
InChI:InChI=1S/C12H16FN.ClH/c13-11-6-4-5-10(9-11)12(14)7-2-1-3-8-12;/h4-6,9H,1-3,7-8,14H2;1H
InChI key:InChIKey=BARCOTMUPUMNSC-UHFFFAOYSA-N
SMILES:NC1(C2=CC(F)=CC=C2)CCCCC1.Cl
Synonyms:- Cyclohexanamine, 1-(3-fluorophenyl)-, hydrochloride (1:1)
- Cyclohexanamine, 1-(3-fluorophenyl)-, hydrochloride
- 1-(3-Fluorophenyl)-cyclohexanamine hydrochloride
- 1-(3-Fluorophenyl)-cyclohexanaMine HCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.