CAS 125802-23-5

1-[3-(Trifluoromethyl)phenyl]cyclohexanamine

Description:

1-[3-(Trifluoromethyl)phenyl]cyclohexanamine, with the CAS number 125802-23-5, is an organic compound characterized by its cyclohexanamine structure substituted with a trifluoromethyl group on a phenyl ring. This compound typically exhibits properties associated with both amines and aromatic compounds, including potential basicity due to the amine functional group. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its reactivity and interaction with biological systems. It is likely to be a solid at room temperature, with a relatively high melting point compared to non-substituted cyclohexanamines. The trifluoromethyl group can also impart unique electronic properties, making the compound of interest in medicinal chemistry and materials science. Additionally, the compound may exhibit specific solubility characteristics in various organic solvents, which can be important for its application in synthesis or as a reagent. Overall, this compound's unique structure suggests potential utility in various chemical and pharmaceutical applications, although specific reactivity and stability would depend on the surrounding conditions.

Formula: C₁₃H₁₆F₃N

InChI: InChI=1S/C13H16F3N/c14-13(15,16)11-6-4-5-10(9-11)12(17)7-2-1-3-8-12/h4-6,9H,1-3,7-8,17H2

InChI key: InChIKey=UBLNVYIKUWTTQA-UHFFFAOYSA-N

SMILES: NC1(CCCCC1)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• 1-[3-(Trifluoromethyl)phenyl]cyclohexanamine
• Cyclohexanamine, 1-[3-(trifluoromethyl)phenyl]-
• 1-[3-(Trifluoromethyl)phenyl]cyclohexan-1-amine