CymitQuimica logo

CAS 125802-37-1

:

1-PHENYLCYCLOHEPTYLAMINE HYDROCHLORIDE

Description:
1-Phenylcycloheptylamine hydrochloride is a chemical compound characterized by its amine functional group and a cycloheptane ring structure. It features a phenyl group attached to a cycloheptyl amine, which contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit biological activity, potentially influencing neurotransmitter systems, which makes it of interest in medicinal chemistry. Its molecular structure suggests it could interact with various receptors, although specific pharmacological profiles would depend on further empirical studies. Safety data and handling precautions should be observed, as with any chemical substance, particularly those involving amines, which can be sensitive to oxidation and may require careful storage conditions. Overall, 1-phenylcycloheptylamine hydrochloride represents a compound with potential applications in research and development within the fields of organic chemistry and pharmacology.
Formula:C13H20ClN
InChI:InChI=1/C13H19N.ClH/c14-13(10-6-1-2-7-11-13)12-8-4-3-5-9-12;/h3-5,8-9H,1-2,6-7,10-11,14H2;1H
SMILES:C1CCCC(CC1)(c1ccccc1)N.Cl
Synonyms:
  • 1-Phenylcycloheptylamine Hydrochloride, 95+%
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.