CAS 125802-43-9

9H-Purin-6-amine, 2-chloro-N-phenyl-9-(phenylmethyl)-, hydrochloride (1:1)

Description:

9H-Purin-6-amine, 2-chloro-N-phenyl-9-(phenylmethyl)-, hydrochloride (1:1), with CAS number 125802-43-9, is a chemical compound that belongs to the purine class of compounds, which are characterized by a fused double-ring structure containing nitrogen atoms. This specific compound features a 2-chloro substituent and a phenylmethyl group, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, which can enhance its bioavailability in pharmaceutical applications. The presence of the amine group suggests potential for hydrogen bonding, influencing its interactions with biological targets. Compounds of this nature are often investigated for their roles in medicinal chemistry, particularly in the development of therapeutics targeting various diseases, including cancer and viral infections. The specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which the compound is studied or utilized.

Formula: C₁₈H₁₄ClN₅·ClH

InChI: InChI=1S/C18H14ClN5.ClH/c19-18-22-16(21-14-9-5-2-6-10-14)15-17(23-18)24(12-20-15)11-13-7-3-1-4-8-13;/h1-10,12H,11H2,(H,21,22,23);1H

InChI key: InChIKey=OQMABXXKKTZDON-UHFFFAOYSA-N

SMILES: N(C1=C2C(N(CC3=CC=CC=C3)C=N2)=NC(Cl)=N1)C4=CC=CC=C4.Cl

Synonyms:

• 9H-Purin-6-amine, 2-chloro-N-phenyl-9-(phenylmethyl)-, monohydrochloride
• 9H-Purin-6-amine, 2-chloro-N-phenyl-9-(phenylmethyl)-, hydrochloride (1:1)

9H-Purin-6-amine, 2-chloro-N-phenyl-9-(phenylmethyl)-, hydrochloride (1:1)

CAS: 125802-43-9

Formula: C₁₈H₁₅Cl₂N₅

Molecular weight: 372.2512

Ref: IN-DA000ORX