CAS 125810-59-5

1H-1,2,3-Triazole-4,5-dicarboxylic acid, 4,5-dihydrazide

Description:

1H-1,2,3-Triazole-4,5-dicarboxylic acid, 4,5-dihydrazide, known by its CAS number 125810-59-5, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features two carboxylic acid groups and two hydrazide functional groups, contributing to its potential reactivity and solubility in polar solvents. The presence of the triazole moiety imparts unique properties, making it of interest in various fields, including pharmaceuticals and agrochemicals. It may exhibit biological activity, potentially acting as a ligand or a precursor in the synthesis of more complex molecules. The compound's ability to form hydrogen bonds due to its functional groups enhances its interactions with other molecules, which can be advantageous in drug design and material science. Additionally, its stability under various conditions makes it a candidate for further research and application in synthetic chemistry. Overall, this compound represents a versatile building block in organic synthesis and medicinal chemistry.

Formula: C₄H₇N₇O₂

InChI: InChI=1S/C4H7N7O2/c5-7-3(12)1-2(4(13)8-6)10-11-9-1/h5-6H2,(H,7,12)(H,8,13)(H,9,10,11)

InChI key: InChIKey=YFGFXLNOZXMDSD-UHFFFAOYSA-N

SMILES: C(NN)(=O)C1=C(C(NN)=O)N=NN1

Synonyms:

• 1H-1,2,3-Triazole-4,5-dicarboxylic acid, dihydrazide
• NSC 679057
• 1H-1,2,3-Triazole-4,5-dicarboxylic acid, 4,5-dihydrazide