CAS 125811-13-4
:6-Fluorobenz(e)acephenanthrylene
Description:
6-Fluorobenz(e)acephenanthrylene is an organic compound characterized by its polycyclic aromatic structure, which includes a fluorine atom substituent. This compound belongs to a class of chemicals known for their planar structures and potential applications in organic electronics and materials science. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its stability and reactivity compared to its non-fluorinated counterparts. Typically, compounds like 6-Fluorobenz(e)acephenanthrylene exhibit properties such as fluorescence, which can be harnessed in various applications, including organic light-emitting diodes (OLEDs) and sensors. Additionally, due to its polycyclic nature, it may also exhibit hydrophobic characteristics, affecting its solubility in different solvents. The compound's synthesis and characterization often involve advanced techniques such as spectroscopy and chromatography to confirm its structure and purity. Overall, 6-Fluorobenz(e)acephenanthrylene represents a significant interest in the field of organic chemistry and materials science due to its unique properties and potential applications.
Formula:C20H11F
InChI:InChI=1/C20H11F/c21-13-8-9-15-17-7-3-6-16-14-5-2-1-4-12(14)10-19(20(16)17)18(15)11-13/h1-11H
SMILES:c1ccc2c(c1)cc1c3cc(ccc3c3cccc2c13)F
Synonyms:- Benz(e)acephenanthrylene, 6-fluoro-
- 6-Fluorobenzo[E]Acephenanthrylene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
