
CAS 125814-21-3
:9H-Fluoren-9-ylmethyl (4S)-4-(2-methylpropyl)-2,5-dioxo-3-oxazolidinecarboxylate
Description:
9H-Fluoren-9-ylmethyl (4S)-4-(2-methylpropyl)-2,5-dioxo-3-oxazolidinecarboxylate is a chemical compound characterized by its complex structure, which includes a fluorenylmethyl group and an oxazolidinecarboxylate moiety. This compound features a chiral center, indicated by the (4S) designation, which contributes to its stereochemical properties and potential biological activity. The presence of the dioxo and oxazolidine functionalities suggests that it may participate in various chemical reactions, including those involving nucleophiles or electrophiles. Its molecular structure may confer specific solubility characteristics, influencing its behavior in different solvents. Additionally, the compound's potential applications could span medicinal chemistry, particularly in the development of pharmaceuticals, due to the oxazolidine framework, which is often associated with antibiotic properties. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH, temperature, and the presence of catalysts or other reagents.
Formula:C22H21NO5
InChI:InChI=1S/C22H21NO5/c1-13(2)11-19-20(24)28-22(26)23(19)21(25)27-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18-19H,11-12H2,1-2H3/t19-/m0/s1
InChI key:InChIKey=FUSUFTVAQIREOR-IBGZPJMESA-N
SMILES:C(OC(=O)N1[C@@H](CC(C)C)C(=O)OC1=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:- 3-Oxazolidinecarboxylic acid, 4-(2-methylpropyl)-2,5-dioxo-, 9H-fluoren-9-ylmethyl ester, (S)-
- 9H-Fluoren-9-ylmethyl (4S)-4-(2-methylpropyl)-2,5-dioxo-3-oxazolidinecarboxylate
- 3-Oxazolidinecarboxylic acid, 4-(2-methylpropyl)-2,5-dioxo-, 9H-fluoren-9-ylmethyl ester, (4S)-
- N-9-Fluorenylmethoxycarbonylleucine N-carboxyanhydride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.