CAS 125814-30-4
:1,1-Dimethylethyl (4S)-4-methyl-2,5-dioxo-3-oxazolidinecarboxylate
Description:
1,1-Dimethylethyl (4S)-4-methyl-2,5-dioxo-3-oxazolidinecarboxylate, with the CAS number 125814-30-4, is a chemical compound characterized by its oxazolidine structure, which includes a five-membered ring containing nitrogen and oxygen atoms. This compound features a dioxo functional group, indicating the presence of two carbonyl groups, which contributes to its reactivity and potential applications in organic synthesis. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, influencing its solubility and interaction with other molecules. The stereochemistry at the 4-position, denoted as (4S), suggests specific spatial arrangements that can affect the compound's biological activity and reactivity. This compound may be of interest in pharmaceutical chemistry and materials science due to its unique structural features, which can facilitate the development of novel compounds or intermediates. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in a laboratory setting.
Formula:C9H13NO5
InChI:InChI=1S/C9H13NO5/c1-5-6(11)14-7(12)10(5)8(13)15-9(2,3)4/h5H,1-4H3/t5-/m0/s1
InChI key:InChIKey=UNPJIXJNLUVVRF-YFKPBYRVSA-N
SMILES:C(OC(C)(C)C)(=O)N1[C@@H](C)C(=O)OC1=O
Synonyms:- 1,1-Dimethylethyl (4S)-4-methyl-2,5-dioxo-3-oxazolidinecarboxylate
- (S)-tert-Butyl4-methyl-2,5-dioxooxazolidine-3-carboxylate
- 3-Oxazolidinecarboxylic acid, 4-methyl-2,5-dioxo-, 1,1-dimethylethyl ester, (S)-
- 3-Oxazolidinecarboxylic acid, 4-methyl-2,5-dioxo-, 1,1-dimethylethyl ester, (4S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(S)-tert-Butyl 4-methyl-2,5-dioxooxazolidine-3-carboxylate
CAS:Formula:C9H13NO5Molecular weight:215.2032
