CAS 125815-68-1
:2-AMINO-4-CYANO-5-IMIDAZOLECARBOXAMIDE
Description:
2-Amino-4-cyano-5-imidazolecarboxamide, with the CAS number 125815-68-1, is a chemical compound characterized by its imidazole ring structure, which contributes to its biological activity. This compound features an amino group and a cyano group, which enhance its reactivity and potential interactions in various chemical environments. It is typically a solid at room temperature and is soluble in polar solvents, reflecting its polar functional groups. The presence of the imidazole moiety suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the cyano group may impart unique electronic properties, making it useful in synthetic chemistry. Its stability under standard conditions allows for various synthetic manipulations, although care must be taken due to the potential reactivity of the cyano and amino groups. Overall, 2-amino-4-cyano-5-imidazolecarboxamide is a compound of interest in both academic research and industrial applications, particularly in medicinal chemistry and material science.
Formula:C5H5N5O
InChI:InChI=1/C5H5N5O/c6-1-2-3(4(7)11)10-5(8)9-2/h(H2,7,11)(H3,8,9,10)
SMILES:C(#N)c1c(C(=O)N)[nH]c(=N)[nH]1
Synonyms:- 1H-Imidazole-4-carboxamide,2-amino-5-cyano-(9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Amino-4-cyano-1H-imidazole-5-carboxamide
CAS:Formula:C5H5N5OColor and Shape:SolidMolecular weight:151.12612-Amino-4-cyano-5-imidazolecarboxamide
CAS:<p>Applications 2-Amino-4-cyano-5-imidazolecarboxamide (cas# 125815-68-1) is a compound useful in organic synthesis.<br></p>Formula:C5H5N5OColor and Shape:NeatMolecular weight:151.13

