CAS 125836-69-3

flunoxaprofen isocyanate

Description:

Flunoxaprofen isocyanate, with the CAS number 125836-69-3, is a chemical compound derived from flunoxaprofen, a non-steroidal anti-inflammatory drug (NSAID). As an isocyanate, it contains the functional group -N=C=O, which is known for its reactivity, particularly in forming urethanes and other derivatives through reactions with alcohols and amines. This compound is characterized by its potential use in medicinal chemistry and materials science, where isocyanates are often employed in the synthesis of polymers and other complex organic molecules. Flunoxaprofen itself is recognized for its analgesic and anti-inflammatory properties, and the isocyanate derivative may exhibit unique biological activities or reactivity profiles. However, isocyanates are also known for their toxicity and potential to cause respiratory irritation, making safety precautions essential when handling such compounds. Overall, flunoxaprofen isocyanate represents a specialized chemical with applications that may extend beyond pharmaceuticals into industrial chemistry.

Formula: C₁₆H₁₁FN₂O₂

InChI: InChI=1/C16H11FN2O2/c1-10(18-9-20)12-4-7-15-14(8-12)19-16(21-15)11-2-5-13(17)6-3-11/h2-8,10H,1H3/t10-/m0/s1

Synonyms:

• (S)-2-(4-Fluorophenyl)-5-(1-isocyanatoethyl)benzoxazole
• Benzoxazole, 2-(4-fluorophenyl)-5-(1-isocyanatoethyl)-, (S)-
• 2-(4-fluorophenyl)-5-[(1S)-1-isocyanatoethyl]-1,3-benzoxazole