CAS 1258405-86-5

Benzene, 1-fluoro-4-isocyano-2-methyl-

Description:

Benzene, 1-fluoro-4-isocyano-2-methyl- is an organic compound characterized by the presence of a benzene ring substituted with a fluorine atom, an isocyanide group, and a methyl group. The molecular structure features a fluorine atom at the para position relative to the isocyanide group, which contributes to its reactivity and potential applications in organic synthesis. The isocyanide functional group is known for its unique reactivity, often participating in nucleophilic addition reactions. This compound may exhibit properties typical of aromatic compounds, such as stability and distinct electronic characteristics due to resonance. Additionally, the presence of the fluorine atom can influence the compound's polarity and solubility in various solvents. While specific physical properties such as boiling point, melting point, and density are not provided, compounds of this nature typically have moderate volatility and may be hazardous, necessitating careful handling and storage. Overall, Benzene, 1-fluoro-4-isocyano-2-methyl- represents a versatile structure in the realm of synthetic organic chemistry.

Formula: C₈H₆FN

InChI: InChI=1S/C8H6FN/c1-6-5-7(10-2)3-4-8(6)9/h3-5H,1H3

InChI key: InChIKey=BGJLICCTTDUQTE-UHFFFAOYSA-N

SMILES: [N+](#[C-])C1=CC(C)=C(F)C=C1

Synonyms:

• Benzene, 1-fluoro-4-isocyano-2-methyl-
• 1-Fluoro-4-isocyano-2-methylbenzene