CAS 1258406-15-3

1H-Pyrrolo[2,3-b]pyridin-3-ol

Description:

1H-Pyrrolo[2,3-b]pyridin-3-ol is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a hydroxyl group (-OH) at the 3-position of the pyridine ring, enhancing its potential for hydrogen bonding and reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxyl group. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the fused ring system can influence biological activity. Additionally, its unique electronic properties may make it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of both nitrogen atoms in the rings can also affect its basicity and acidity, making it an interesting subject for further study in organic synthesis and material science. Overall, 1H-Pyrrolo[2,3-b]pyridin-3-ol is a compound of interest due to its structural features and potential applications in various fields.

Formula: C₇H₆N₂O

InChI: InChI=1S/C7H6N2O/c10-6-4-9-7-5(6)2-1-3-8-7/h1-4,10H,(H,8,9)

InChI key: InChIKey=NVHACOHMMJMOCC-UHFFFAOYSA-N

SMILES: OC=1C=2C(=NC=CC2)NC1

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridin-3-ol