CAS 1258430-92-0
:5′-Bromo-1,2,3,5,6,7-hexahydrospiro[4H-azepine-4,2′(3′H)-benzofuran]
Description:
5′-Bromo-1,2,3,5,6,7-hexahydrospiro[4H-azepine-4,2′(3′H)-benzofuran] is a complex organic compound characterized by its unique spirocyclic structure, which combines a benzofuran moiety with a hexahydroazepine framework. The presence of a bromine atom at the 5′ position introduces significant reactivity, making it a potential candidate for various chemical transformations. This compound exhibits properties typical of heterocyclic compounds, including potential biological activity, which may be explored in medicinal chemistry. Its structural features suggest it could participate in hydrogen bonding and π-π interactions, influencing its solubility and reactivity. The hexahydro component indicates saturation, which may affect its stability and interaction with other molecules. As with many complex organic compounds, its synthesis and characterization would require advanced techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, with potential applications in drug development and material science.
Formula:C13H16BrNO
InChI:InChI=1S/C13H16BrNO/c14-11-2-3-12-10(8-11)9-13(16-12)4-1-6-15-7-5-13/h2-3,8,15H,1,4-7,9H2
InChI key:InChIKey=WAZOPGJVADVJSD-UHFFFAOYSA-N
SMILES:BrC=1C=C2CC3(OC2=CC1)CCCNCC3
Synonyms:- Spiro[4H-azepine-4,2′(3′H)-benzofuran], 5′-bromo-1,2,3,5,6,7-hexahydro-
- 5′-Bromo-1,2,3,5,6,7-hexahydrospiro[4H-azepine-4,2′(3′H)-benzofuran]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
