
CAS 1258440-64-0
:2-Bromo-5-[3-chloro-4-(1-methylethoxy)phenyl]-1,3,4-thiadiazole
Description:
2-Bromo-5-[3-chloro-4-(1-methylethoxy)phenyl]-1,3,4-thiadiazole is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and various substituents that contribute to its chemical properties. The presence of bromine and chlorine atoms indicates that it may exhibit halogen-related reactivity, potentially participating in nucleophilic substitution reactions. The 1-methylethoxy group suggests that the compound may have moderate lipophilicity, influencing its solubility in organic solvents. Thiadiazoles are known for their biological activity, and this compound may possess pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure can lead to diverse interactions with biological targets, which could be explored for potential therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, making it a candidate for further research in synthetic and medicinal chemistry. Overall, 2-Bromo-5-[3-chloro-4-(1-methylethoxy)phenyl]-1,3,4-thiadiazole represents a complex molecule with potential utility in various chemical and biological contexts.
Formula:C11H10BrClN2OS
InChI:InChI=1S/C11H10BrClN2OS/c1-6(2)16-9-4-3-7(5-8(9)13)10-14-15-11(12)17-10/h3-6H,1-2H3
InChI key:InChIKey=UZNDXSJHAVHWFH-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1OC(C)C)C2=NN=C(Br)S2
Synonyms:- 2-Bromo-5-(3-chloro-4-isopropoxyphenyl)-1,3,4-thiadiazole
- 1,3,4-Thiadiazole, 2-bromo-5-[3-chloro-4-(1-methylethoxy)phenyl]-
- 2-Bromo-5-[3-chloro-4-[(1-methylethyl)oxy]phenyl]-1,3,4-thiadiazole
- 2-Bromo-5-[3-chloro-4-(1-methylethoxy)phenyl]-1,3,4-thiadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.