CAS 1258597-61-3

N-[2-[1-[3-(Ethoxy-1,1,2,2,2-d5)-4-methoxyphenyl]-2-(methylsulfonyl)ethyl]-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]acetamide

Description:

N-[2-[1-[3-(Ethoxy-1,1,2,2,2-d5)-4-methoxyphenyl]-2-(methylsulfonyl)ethyl]-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]acetamide, with CAS number 1258597-61-3, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as an amide, methoxy, and sulfonyl moieties. This compound features a dioxo isoindole core, contributing to its potential biological activity. The presence of the ethoxy group, particularly with deuterium substitution, suggests applications in isotopic labeling studies or pharmacokinetic investigations. Its structural components indicate potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity would depend on its specific functional groups and overall molecular conformation. As with many synthetic compounds, safety and handling precautions are essential, particularly in laboratory settings, to mitigate any potential hazards associated with its use. Further studies would be necessary to elucidate its pharmacological properties and potential applications in drug development.

Formula: C₂₂H₁₉D₅N₂O₇S

InChI: InChI=1S/C22H24N2O7S/c1-5-31-19-11-14(9-10-18(19)30-3)17(12-32(4,28)29)24-21(26)15-7-6-8-16(23-13(2)25)20(15)22(24)27/h6-11,17H,5,12H2,1-4H3,(H,23,25)/i1D3,5D2

InChI key: InChIKey=IMOZEMNVLZVGJZ-RPIBLTHZSA-N

SMILES: C(CS(C)(=O)=O)(N1C(=O)C=2C(C1=O)=CC=CC2NC(C)=O)C3=CC(OC(C([2H])([2H])[2H])([2H])[2H])=C(OC)C=C3

Synonyms:

• N-[2-[1-[3-(Ethoxy-1,1,2,2,2-d5)-4-methoxyphenyl]-2-(methylsulfonyl)ethyl]-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]acetamide
• Acetamide, N-[2-[1-[3-(ethoxy-1,1,2,2,2-d5)-4-methoxyphenyl]-2-(methylsulfonyl)ethyl]-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]-

(Rac)-Apremilast D5

CAS: 1258597-61-3

(Rac)-Apremilast D5 is a deuterium-labeled version of the enantiomer (R)-Apremilast, also known as (R)-CC-10004, which itself is one specific form of Apremilast

Formula: C₂₂H₂₄N₂O₇S

Purity: 98%

Color and Shape: Solid

Molecular weight: 465.53

Ref: TM-T12656