CAS 1258614-87-7

4-(3,5-Dimethoxyphenyl)-2-pyridinecarboxylic acid

Description:

4-(3,5-Dimethoxyphenyl)-2-pyridinecarboxylic acid, identified by its CAS number 1258614-87-7, is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenyl group with two methoxy substituents. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions and may serve as a ligand in coordination chemistry. Additionally, the methoxy groups can influence the compound's solubility and reactivity, often enhancing its lipophilicity. This compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopy methods like NMR and mass spectrometry for structural confirmation. Overall, 4-(3,5-Dimethoxyphenyl)-2-pyridinecarboxylic acid represents a versatile molecule with potential applications in medicinal chemistry and material science.

Formula: C₁₄H₁₃NO₄

InChI: InChI=1S/C14H13NO4/c1-18-11-5-10(6-12(8-11)19-2)9-3-4-15-13(7-9)14(16)17/h3-8H,1-2H3,(H,16,17)

InChI key: InChIKey=SUPFDWAJWZOOKP-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=C(OC)C1)C=2C=C(C(O)=O)N=CC2

Synonyms:

• 2-Pyridinecarboxylic acid, 4-(3,5-dimethoxyphenyl)-
• 4-(3,5-Dimethoxyphenyl)-2-pyridinecarboxylic acid