CAS 1258615-89-2

3-Pyridinecarboxylic acid, 2-(4-hydroxyphenyl)-

Description:

3-Pyridinecarboxylic acid, 2-(4-hydroxyphenyl)-, also known by its CAS number 1258615-89-2, is an organic compound characterized by its pyridine and phenolic functional groups. This compound features a pyridine ring substituted with a carboxylic acid group at the 3-position and a 4-hydroxyphenyl group at the 2-position. It is typically a solid at room temperature and exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid and hydroxyl groups, which can engage in hydrogen bonding. The compound may display acidic properties due to the carboxylic acid functionality, and its phenolic group can contribute to antioxidant activity. Additionally, the presence of both aromatic and heterocyclic structures suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Its specific reactivity and stability can be influenced by the substituents on the rings, making it a subject of interest in medicinal chemistry and materials science.

Formula: C₁₂H₉NO₃

InChI: InChI=1S/C12H9NO3/c14-9-5-3-8(4-6-9)11-10(12(15)16)2-1-7-13-11/h1-7,14H,(H,15,16)

InChI key: InChIKey=YMKLWITWFQRFHY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N=CC=C1)C2=CC=C(O)C=C2

Synonyms:

• 3-Pyridinecarboxylic acid, 2-(4-hydroxyphenyl)-